Molecule Details
| InChIKey | ZZJLMZYUGLJBSO-LAEOZQHASA-N |
|---|---|
| Canonical SMILES | C[C@H](N)C(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.8 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15286 |
|---|---|
| Drug Name | Numidargistat |
| CAS Number | 2095732-06-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | CB-1158 is under investigation in clinical trial NCT03910530 (A Study of INCMGA00012, INCB001158, and the Combination in Japanese Participants With Advanced Solid Tumors). |
Categories: Enzyme Inhibitors
Cross-references: ChemSpider: 72379905