Molecule Details
| InChIKey | ZWTVVWUOTJRXKM-UHFFFAOYSA-N |
|---|---|
| Compound Name | Tonapofylline |
| Canonical SMILES | CCCn1c(=O)c2[nH]c(C34CCC(CCC(=O)O)(CC3)CC4)nc2n(CCC)c1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.6 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12569 |
|---|---|
| Drug Name | Tonapofylline |
| CAS Number | 340021-17-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tonapofylline has been used in trials studying the treatment of Heart Failure, Renal Insufficiency, and Congestive Heart Failure. |
Categories: Alkaloids Heterocyclic Compounds, Fused-Ring Purines Purinones Receptor, Adenosine A1
Cross-references: BindingDB: 50199293 CHEMBL414157 ChemSpider: 187607 PubChem:216466 PubChem:347828791 ZINC: ZINC000000603777