Molecule Details
| InChIKey | ZVQUCWXZCKWZBP-CQSZACIVSA-N |
|---|---|
| Compound Name | Tecalcet |
| Canonical SMILES | COc1cccc([C@@H](C)NCCCc2ccccc2Cl)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.69 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20329 |
|---|---|
| Drug Name | Tecalcet |
| CAS Number | 148717-54-8 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Tecalcet is a small molecule drug. The usage of the INN stem '-calcet/-calcet-' in the name indicates that Tecalcet is a calcium-sensing receptor (CaSR) agonist. Tecalcet has a monoisotopic molecular weight of 303.14 Da. |
Cross-references: BindingDB: 50432960 CHEMBL292376 PDB: 9IG ZINC: ZINC000001538900
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 7.4 | Ki | ChEMBL |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 7.4 | Ki | ChEMBL |
| Q5BJF2 | TMEM97 | Homo sapiens | Human | PF05241 | 7.1 | Ki | ChEMBL |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.8 | Ki | ChEMBL |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 6.7 | Ki | ChEMBL |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL |