Molecule Details
| InChIKey | ZUXPFTYMSHPRQX-GFCCVEGCSA-N |
|---|---|
| Canonical SMILES | Cn1cnc2ccc(Oc3c(F)ccc(NS(=O)(=O)N4CC[C@@H](F)C4)c3C#N)cc2c1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.92 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21673 |
|---|---|
| Drug Name | Mosperafenib |
| CAS Number | 2649372-20-1 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Mosperafenib is a small molecule drug. The usage of the INN stem '-rafenib' in the name indicates that Mosperafenib is a Raf (rapidly accelerated fibrosarcoma) kinase inhibitor. Mosperafenib has a monoisotopic molecular weight of 461.1 Da. |
Cross-references: BindingDB: 677074 CHEMBL6068061