Molecule Details
| InChIKey | ZTVIKZXZYLEVOL-MCOXGKPRSA-N |
|---|---|
| Canonical SMILES | CN1[C@@H]2CC[C@H]1C[C@@H](OC(=O)C(O)c1ccccc1)C2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.26 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11181 |
|---|---|
| Drug Name | Homatropine |
| CAS Number | 87-00-3 |
| Groups | approved |
| ATC Codes | S01FA05 |
| Description | Homatropine is an anticholinergic drug that acts as an antagonist at muscarinic acetylcholine receptors. It is present in antitussives, under the trade name Hycodan, in combination with hydrocodone (dihydrocodeinone) bitartrate indicated for the symptomatic relief of cough as oral tablets or solutio... |
Categories: Alkaloids Anticholinergic Agents Autonomic Agents Aza Compounds Azabicyclo Compounds Muscarinic Antagonists Mydriatics and Cycloplegics Ophthalmologicals Parasympatholytics Peripheral Nervous System Agents Sensory Organs
Cross-references: BindingDB: 50240066 ChEBI: 5747 CHEMBL1618018 ChemSpider: 16498795 Drugs Product Database (DPD): 8954 C07814 PubChem:347911146 RxCUI: 27084 Wikipedia: Homatropine
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P20309 | CHRM3 | Homo sapiens | Human | PF00001 | 7.5 | IC50 | ChEMBL |
| P08173 | CHRM4 | Homo sapiens | Human | PF00001 | 7.4 | IC50 | ChEMBL |
| P08912 | CHRM5 | Homo sapiens | Human | PF00001 | 7.3 | IC50 | ChEMBL |
| P11229 | CHRM1 | Homo sapiens | Human | PF00001 | 7.2 | IC50 | ChEMBL |
| P08172 | CHRM2 | Homo sapiens | Human | PF00001 | 6.9 | IC50 | ChEMBL |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P23141 | CES1 | Liver carboxylesterase 1 | substrate | enzymes |
| P08172 | CHRM2 | Muscarinic acetylcholine receptor M2 | antagonist | targets |
| P08173 | CHRM4 | Muscarinic acetylcholine receptor M4 | antagonist | targets |
| P08912 | CHRM5 | Muscarinic acetylcholine receptor M5 | antagonist | targets |
| P11229 | CHRM1 | Muscarinic acetylcholine receptor M1 | antagonist | targets |
| P20309 | CHRM3 | Muscarinic acetylcholine receptor M3 | antagonist | targets |