Molecule Details
| InChIKey | ZSKVGTPCRGIANV-ZXFLCMHBSA-N |
|---|---|
| Compound Name | Imipenem |
| Canonical SMILES | C[C@@H](O)[C@H]1C(=O)N2C(C(=O)O)=C(SCCNC=N)C[C@H]12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.76 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01598 |
|---|---|
| Drug Name | Imipenem |
| CAS Number | 64221-86-9 |
| Groups | approved investigational |
| ATC Codes | J01DH51 J01DH56 |
| Description | Imipenem is a semisynthetic thienamycin that has a wide spectrum of antibacterial activity against gram-negative and gram-positive aerobic and anaerobic bacteria, including many multiresistant strains.[label] It is stable to many beta-lactamases. Similar compounds include [meropenem], known for havi... |
Categories: Agents that reduce seizure threshold Amides Anti-Bacterial Agents Anti-Infective Agents Antibacterials for Systemic Use Antiinfectives for Systemic Use Beta-Lactam Antibacterials Carbapenems Heterocyclic Compounds, Fused-Ring Lactams Neurotoxic agents Penem Antibacterial Sulfur Compounds Thienamycins beta-Lactams
Cross-references: BindingDB: 50213266 ChEBI: 190509 CHEMBL148 ChemSpider: 94631 Drugs Product Database (DPD): 1390 C06665 PharmGKB: PA449968 PubChem:104838 PubChem:46505744 RxCUI: 1545986 Therapeutic Targets Database: DAP000459 Wikipedia: Imipenem ZINC: ZINC000004097225
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q2TL65 | pbpA | Escherichia coli | Pathogen | PF03717 PF00905 | 7.5 | IC50 | BindingDB |
| D1MIX9 | blaGES-13 | Pseudomonas aeruginosa | Pathogen | PF13354 | 6.8 | IC50 | ChEMBL;BindingDB |
| Q53707 | mecA | Staphylococcus aureus | Pathogen | PF05223 PF03717 PF00905 | 6.7 | IC50 | BindingDB |
| P0A3M5 | penA | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | Pathogen | PF03717 PF00905 | 6.7 | IC50 | BindingDB |
| P14677 | pbpX | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | Pathogen | PF03793 PF03717 PF00905 | 6.6 | IC50 | BindingDB |
| Q04707 | ponA | Streptococcus pneumoniae serotype 4 (strain ATCC BAA-334 / TIGR4) | Pathogen | PF00912 PF00905 | 6.5 | IC50 | BindingDB |
| Q51504 | pbpB | Pseudomonas aeruginosa | Pathogen | PF03717 PF00905 | 6.5 | IC50 | BindingDB |
DrugBank Target Actions (11)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P0AD63 | bla | Beta-lactamase SHV-1 | substrate | enzymes |
| P16444 | P16444 | Dipeptidase 1 | substrate | enzymes |
| P62593 | bla | Beta-lactamase TEM | substrate | enzymes |
| Q939N4 | Q939N4 | Beta-lactamase CTX-M | substrate | enzymes |
| Q93LQ9 | KPC-2 | Beta-lactamase | substrate | enzymes |
| P52664 | P52664 | Beta-lactamase | activator | targets |
| P02918 | P02918 | Penicillin-binding protein 1A | inhibitor | targets |
| P02919 | P02919 | Penicillin-binding protein 1B | inhibitor | targets |
| P0AD65 | mrdA | Peptidoglycan D,D-transpeptidase MrdA | inhibitor | targets |
| P42971 | P42971 | Penicillin-binding protein 3 | inhibitor | targets |
| P72355 | P72355 | Penicillin-binding protein 4 | inhibitor | targets |