Molecule Details
| InChIKey | ZRVUJXDFFKFLMG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Meloxicam |
| Canonical SMILES | Cc1cnc(NC(=O)C2=C(O)c3ccccc3S(=O)(=O)N2C)s1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.72 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00814 |
|---|---|
| Drug Name | Meloxicam |
| CAS Number | 71125-38-7 |
| Groups | approved investigational vet_approved |
| ATC Codes | N01BB59 M01AC56 M01AC06 |
| Description | Meloxicam is a nonsteroidal anti-inflammatory drug (NSAID) used to relieve various types of pain, including pain caused by musculoskeletal conditions, osteoarthritis, and rheumatoid arthritis.[A190189] With a longer half-life than most other NSAIDS, it is a favorable option for those who require onc... |
Categories: Agents causing hyperkalemia Agents that produce hypertension Amides Analgesics Analgesics, Non-Narcotic Anesthetics Anesthetics, Local Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Anti-Inflammatory Agents, Non-Steroidal (Non-Selective) Antiinflammatory and Antirheumatic Products Antiinflammatory and Antirheumatic Products, Non-Steroids Antirheumatic Agents COX-2 Inhibitors Cyclooxygenase Inhibitors Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Musculo-Skeletal System Nephrotoxic agents Nervous System Other Nonsteroidal Anti-inflammatory Agents Oxicams Peripheral Nervous System Agents Selective Cyclooxygenase 2 Inhibitors (NSAIDs) Sensory System Agents Sulfur Compounds Thiazines Thiazoles
Cross-references: BindingDB: 50056998 ChEBI: 6741 CHEMBL599 ChemSpider: 10442740 Drugs Product Database (DPD): 11764 C08169 D00969 PDB: MXM PharmGKB: PA450353 PubChem:54677470 PubChem:46506624 RxCUI: 41493 Therapeutic Targets Database: DAP000971 Wikipedia: Meloxicam ZINC: ZINC000013129998
Target Activities (2)
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| P52209 | PGD | 6-phosphogluconate dehydrogenase, decarboxylating | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | targets |
| O15439 | O15439 | ATP-binding cassette sub-family C member 4 | binder | transporters |