Molecule Details
| InChIKey | ZROLHBHDLIHEMS-HUUCEWRRSA-N |
|---|---|
| Compound Name | Tetrahydrocannabivarin |
| Canonical SMILES | CCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(C)=C[C@@H]21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.84 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11755 |
|---|---|
| Drug Name | Tetrahydrocannabivarin |
| CAS Number | 31262-37-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tetrahydrocannabivarin (THCV) is a propyl analogue of tetrahydrocannabinol (Δ9-THC), one of the primary pharmacological components of [Medical Cannabis]. Δ9-THC is currently available in several synthetic forms, including [Dronabinol], while purified or isolated THCV is not approved for any medical ... |
Categories: Agents that produce hypertension Antidepressive Agents Central Nervous System Depressants Serotonin 5-HT1 Receptor Agonists Serotonin Agents Serotonin Receptor Agonists
Cross-references: CHEMBL2387541 ChemSpider: 84092 PDB: I8E PubChem:93147 PubChem:347828110 Wikipedia: Tetrahydrocannabivarin ZINC: ZINC000005649505
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q7Z2W7 | TRPM8 | Homo sapiens | Human | PF00520 PF18139 PF25508 | 7.7 | IC50 | ChEMBL;BindingDB |
| P34972 | CNR2 | Homo sapiens | Human | PF00001 | 7.2 | Ki | ChEMBL;BindingDB |
| P21554 | CNR1 | Homo sapiens | Human | PF00001 | 7.1 | Ki | ChEMBL;BindingDB |
| Q9Y5S1 | TRPV2 | Homo sapiens | Human | PF12796 PF00520 | 6.1 | IC50 | ChEMBL;BindingDB |
| O75762 | TRPA1 | Homo sapiens | Human | PF00023 PF12796 PF13637 PF00520 | 6.1 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (8)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q8NET8 | TRPV3 | Transient receptor potential cation channel subfamily V member 3 | activator | targets |
| O75762 | TRPA1 | Transient receptor potential cation channel subfamily A member 1 | agonist | targets |
| P08908 | HTR1A | 5-hydroxytryptamine receptor 1A | agonist | targets |
| Q9Y5S1 | TRPV2 | Transient receptor potential cation channel subfamily V member 2 | agonist | targets |
| P21554 | CNR1 | Cannabinoid receptor 1 | antagonist | targets |
| Q7Z2W7 | TRPM8 | Transient receptor potential cation channel subfamily M member 8 | antagonist | targets |
| P34972 | CNR2 | Cannabinoid receptor 2 | partial agonist | targets |
| Q9Y2T6 | GPR55 | G-protein coupled receptor 55 | partial agonist | targets |