Molecule Details
| InChIKey | ZOBDWFRKFSPCRB-UNMCSNQZSA-N |
|---|---|
| Canonical SMILES | CCc1ccccc1NC(=O)Oc1ccc2c(c1)[C@]1(C)CCN(C)O[C@@H]1N2C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.85 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06525 |
|---|---|
| Drug Name | Ganstigmine |
| CAS Number | 457075-21-7 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Ganstigmine is an orally active, geneserine derived, carbamate-based acetylcholinesterase inhibitor developed for the treatment of Alzheimer's disease. |
Categories: Acids, Acyclic Carbamates Cholinesterase Inhibitors
Cross-references: BindingDB: 10970 CHEMBL121810 ChemSpider: 7999041 ZINC: ZINC000003814007