Molecule Details
| InChIKey | ZMQSLMZOWVGBSM-GXTWGEPZSA-N |
|---|---|
| Canonical SMILES | CC(C)C[C@H](CO)Nc1nc(S[C@@H](C)c2ccccc2)nc2nc(N)sc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.64 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16511 |
|---|---|
| Drug Name | KAND567 |
| CAS Number | 911715-90-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | KAND567, a small molecule, blocks the fractaline (CX3CL1) receptor, which mediates the immune system response to inflammation[L32908]. Because COVID-19 involves cytotoxic cells associated with this pathway, KAND567 is currently being tested as a treatment for those with the illness[L32908]. |
Categories: Experimental Unapproved Treatments for COVID-19
Cross-references: BindingDB: 50432452 CHEMBL2349310 ChemSpider: 10139860 ZINC: ZINC000043132600
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P49238 | CX3CR1 | CX3C chemokine receptor 1 | binder | targets |