Molecule Details
| InChIKey | ZMELOYOKMZBMRB-DLBZAZTESA-N |
|---|---|
| Compound Name | Talmapimod |
| Canonical SMILES | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)c1cc2c(C(=O)C(=O)N(C)C)cn(C)c2cc1Cl |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.9 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05412 |
|---|---|
| Drug Name | Talmapimod |
| CAS Number | 309913-83-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Talmapimod is the first-generation oral p38 MAP kinase inhibitor developed by Scios. It has shown to be effective to cure inflammatory diseases such as Rheumatoid Arthritis. |
Categories: Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50266947 ChEBI: 90683 CHEMBL514201 ChemSpider: 8046764 PDB: 469 PubChem:9871074 PubChem:347827727 ZINC: ZINC000034001955