Molecule Details
| InChIKey | ZININGNRPUGNSL-UHFFFAOYSA-N |
|---|---|
| Compound Name | Orismilast |
| Canonical SMILES | O=C(Cc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c2c1OC1(CCS(=O)(=O)CC1)O2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.87 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB19042 |
|---|---|
| Drug Name | Orismilast |
| CAS Number | 1353546-86-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Orismilast is under investigation in clinical trial NCT05190419 (Study to Assess the Efficacy and Safety of Orismilast in Psoriasis). |
Cross-references: BindingDB: 150200 CHEMBL3654384 ChemSpider: 58956973 ZINC: ZINC000142633616