Molecule Details
| InChIKey | ZHUJMSMQIPIPTF-IBURTVSXSA-N |
|---|---|
| Compound Name | Dadle |
| Canonical SMILES | CC(C)C[C@@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](C)NC(=O)[C@@H](N)Cc1ccc(O)cc1)C(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.23 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08856 |
|---|---|
| Drug Name | DADLE |
| CAS Number | 63631-40-3 |
| Groups | experimental |
| ATC Codes | nan |
| Description | A delta-selective opioid (ANALGESICS, OPIOID). It can cause transient depression of mean arterial blood pressure and heart rate. |
Categories: Amino Acids, Peptides, and Proteins Enkephalin, Leucine Enkephalins Nerve Tissue Proteins Neuropeptides Opioid Peptides Peptides Proteins
Cross-references: BindingDB: 21025 CHEMBL340032 ChemSpider: 5292936 Wikipedia: DADLE ZINC: ZINC000014952092