Molecule Details
| InChIKey | ZHCINJQZDFCSEL-CYBMUJFWSA-N |
|---|---|
| Canonical SMILES | C#C[C@H](CC(=O)OCC)NC(=O)CCC(=O)Nc1ccc(C(=N)N)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.7 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21058 |
|---|---|
| Drug Name | Xemilofiban |
| CAS Number | 149820-74-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Xemilofiban is a small molecule drug. The usage of the INN stem '-fiban' in the name indicates that Xemilofiban is a fibrinogen receptor antagonist (glycoprotein IIb/IIIa receptor antagonist). Xemilofiban has a monoisotopic molecular weight of 358.16 Da. |
Categories: Amidines Antiplatelet agents Hematologic Agents
Cross-references: BindingDB: 50083460 CHEMBL76098 ZINC: ZINC000001535967