Molecule Details
| InChIKey | ZEWQUBUPAILYHI-UHFFFAOYSA-N |
|---|---|
| Compound Name | Trifluoperazine |
| Canonical SMILES | CN1CCN(CCCN2c3ccccc3Sc3ccc(C(F)(F)F)cc32)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 21 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.05 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00831 |
|---|---|
| Drug Name | Trifluoperazine |
| CAS Number | 117-89-5 |
| Groups | approved investigational |
| ATC Codes | N05AB06 |
| Description | A phenothiazine with actions similar to chlorpromazine. It is used as an antipsychotic and an antiemetic. |
Categories: Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Agents that produce hypertension Antiemetics Antipsychotic Agents Antipsychotic Agents (First Generation [Typical]) Autonomic Agents Central Nervous System Agents Central Nervous System Depressants Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 Substrates Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists Drugs causing inadvertant photosensitivity Gastrointestinal Agents Heterocyclic Compounds, Fused-Ring Nervous System Neurotoxic agents Neurotransmitter Agents P-glycoprotein inhibitors P-glycoprotein substrates Peripheral Nervous System Agents Phenothiazines Phenothiazines With Piperazine Structure Photosensitizing Agents Psycholeptics Psychotropic Drugs Sulfur Compounds Tranquilizing Agents UGT1A4 substrates
Cross-references: BindingDB: 79181 ChEBI: 45951 CHEMBL422 ChemSpider: 5365 Drugs Product Database (DPD): 7996 Guide to Pharmacology: 214 IUPHAR: 214 C07168 D08636 PDB: TFP PharmGKB: PA451771 PubChem:5566 PubChem:46507961 RxCUI: 10800 Therapeutic Targets Database: DAP000034 Wikipedia: Trifluoperazine ZINC: ZINC000019418959
Target Activities (21)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 9.3 | Ki | BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 8.9 | Ki | BindingDB |
| Q9BY08 | EBPL | Homo sapiens | Human | PF05241 | 8.4 | Ki | ChEMBL;BindingDB |
| Q15125 | EBP | Homo sapiens | Human | PF05241 | 8.1 | Ki | ChEMBL;BindingDB |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 7.8 | Ki | ChEMBL;BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 7.6 | Ki | BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 7.4 | Ki | BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 7.4 | Ki | BindingDB |
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 7.2 | Ki | BindingDB |
| P50406 | HTR6 | Homo sapiens | Human | PF00001 | 6.8 | Ki | BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.8 | Ki | BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 6.5 | Ki | BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.4 | Ki | BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.4 | Ki | BindingDB |
| P08172 | CHRM2 | Homo sapiens | Human | PF00001 | 6.2 | Ki | BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.2 | Ki | BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 6.0 | Ki | BindingDB |
| P08922 | ROS1 | Homo sapiens | Human | PF00041 PF07714 | 6.0 | IC50 | BindingDB |
| P0DP23 | CALM1 | Homo sapiens | Human | PF13499 | 6.0 | Kd | ChEMBL;BindingDB |
| P32352 | ERG2 | Saccharomyces cerevisiae (strain ATCC 204508 / S288c) | Pathogen | PF04622 | 6.3 | Ki | ChEMBL;BindingDB |
| A3EZJ3 | NS3 | Hepacivirus hominis | Pathogen | PF07652 PF22027 PF02907 | 6.2 | IC50 | ChEMBL |
DrugBank Target Actions (12)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P47989 | XDH | Xanthine dehydrogenase/oxidase | modulator | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P22310 | P22310 | UDP-glucuronosyltransferase 1A4 | substrate | enzymes |
| P63316 | P63316 | Troponin C, slow skeletal and cardiac muscles | allosteric modulator | targets |
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P35348 | ADRA1A | Alpha-1A adrenergic receptor | antagonist | targets |
| Q9NYX4 | Q9NYX4 | Neuron-specific vesicular protein calcyon | antagonist | targets |
| P0DP23 | CALM1 | Calmodulin-1 | inhibitor | targets |
| P0DP24 | P0DP24 | Calmodulin-2 | inhibitor | targets |
| P0DP25 | P0DP25 | Calmodulin-3 | inhibitor | targets |
| P26447 | P26447 | Protein S100-A4 | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |