Molecule Details
| InChIKey | ZBVPUFSKFGYNLC-FIDNPTQWSA-N |
|---|---|
| Canonical SMILES | CC[C@]1(c2cccc(NS(C)(=O)=O)c2)[C@@H]2CN(CC3(O)Cc4ccccc4C3)C[C@@H]21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.81 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12196 |
|---|---|
| Drug Name | CP-866087 |
| CAS Number | 519052-02-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | CP-866,087 has been used in trials studying the treatment of Obesity, Alcoholism, and Sexual Dysfunction, Physiological. |
Categories: Aza Compounds
Cross-references: CHEMBL3219616 ChemSpider: 32700406 PubChem:11154544 PubChem:347828481 ZINC: ZINC000169323664