Molecule Details
| InChIKey | ZAFYATHCZYHLPB-UHFFFAOYSA-N |
|---|---|
| Compound Name | Zolpidem |
| Canonical SMILES | Cc1ccc(-c2nc3ccc(C)cn3c2CC(=O)N(C)C)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.85 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00425 |
|---|---|
| Drug Name | Zolpidem |
| CAS Number | 82626-48-0 |
| Groups | approved investigational |
| ATC Codes | N05CF02 |
| Description | Zolpidem, also known as _Ambien_, is a hypnotic drug that was initially approved by the FDA in 1992 [FDA label]. Zolpidem improves sleep in patients with insomnia. It is aimed for use in patients with difficulties initiating sleep. This drug decreases the time to fall asleep (sleep latency), increas... |
Categories: Benzodiazepine hypnotics and sedatives Central Nervous System Agents Central Nervous System Depressants Central Nervous System Depression Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates GABA Agents GABA Agonists GABA-A Receptor Agonists Hypnotics (Nonbenzodiazepine) Hypnotics and Sedatives Miscellaneous Anxiolytics Sedatives and Hypnotics Nervous System Neurotransmitter Agents Psycholeptics Pyridines Sleep Aids, Pharmaceutical gamma-Aminobutyric Acid A Receptor Positive Modulator gamma-Aminobutyric Acid-ergic Agonist
Cross-references: BindingDB: 26266 ChEBI: 10125 CHEMBL911 ChemSpider: 5530 Drugs Product Database (DPD): 933 C07219 PDB: R5R PharmGKB: PA451976 PubChem:5732 PubChem:46507949 RxCUI: 39993 Therapeutic Targets Database: DAP000112 Wikipedia: Zolpidem ZINC: ZINC000000003876
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P14867 | GABRA1 | Homo sapiens | Human | PF02931 PF02932 | 7.4 | Ki | ChEMBL;BindingDB |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 7.3 | Ki | ChEMBL |
| P18507 | GABRG2 | Homo sapiens | Human | PF02931 PF02932 | 6.8 | Ki | ChEMBL;BindingDB |
| P28472 | GABRB3 | Homo sapiens | Human | PF02931 PF02932 | 6.8 | Ki | ChEMBL |
| P47869 | GABRA2 | Homo sapiens | Human | PF02931 PF02932 | 6.8 | Ki | ChEMBL;BindingDB |
| P34903 | GABRA3 | Homo sapiens | Human | PF02931 PF02932 | 6.4 | Ki | ChEMBL;BindingDB |
| P47870 | GABRB2 | Homo sapiens | Human | PF02931 PF02932 | 6.4 | Ki | ChEMBL |
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| P14867 | GABRA1 | Gamma-aminobutyric acid receptor subunit alpha-1 | agonist | targets |
| P18507 | GABRG2 | Gamma-aminobutyric acid receptor subunit gamma-2 | agonist | targets |
| P34903 | GABRA3 | Gamma-aminobutyric acid receptor subunit alpha-3 | agonist | targets |
| P47869 | GABRA2 | Gamma-aminobutyric acid receptor subunit alpha-2 | agonist | targets |
| Q99928 | GABRG3 | Gamma-aminobutyric acid receptor subunit gamma-3 | allosteric modulator | targets |