Molecule Details
| InChIKey | YZXBAPSDXZZRGB-DOFZRALJSA-N |
|---|---|
| Compound Name | Arachidonic Acid |
| Canonical SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.39 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04557 |
|---|---|
| Drug Name | Arachidonic Acid |
| CAS Number | 506-32-1 |
| Groups | approved investigational withdrawn |
| ATC Codes | nan |
| Description | An unsaturated, essential fatty acid. It is found in animal and human fat as well as in the liver, brain, and glandular organs, and is a constituent of animal phosphatides. It is formed by the synthesis from dietary linoleic acid and is a precursor in the biosynthesis of prostaglandins, thromboxanes... |
Categories: Arachidonic Acids Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 Substrates Eicosanoids Fatty Acids Fatty Acids, Essential Fatty Acids, Unsaturated Lipids
Cross-references: BindingDB: 22319 ChEBI: 15843 CHEMBL15594 ChemSpider: 392692 C00219 PDB: ACD PubChem:444899 PubChem:46506683 RxCUI: 1368624 Therapeutic Targets Database: DNC000249 ZINC: ZINC000004474696
Target Activities (3)
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| P12104 | FABP2 | Fatty acid-binding protein, intestinal | binder | carriers |
| P15090 | FABP4 | Fatty acid-binding protein, adipocyte | binder | carriers |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P19793 | RXRA | Retinoic acid receptor RXR-alpha | binder | targets |
| P29498 | P29498 | 14 kDa fatty acid-binding protein | binder | targets |
| Q07869 | PPARA | Peroxisome proliferator-activated receptor alpha | binder | targets |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | inhibitor | targets |
| Q96RI1 | NR1H4 | Bile acid receptor | ligand | targets |
| Q92959 | SLCO2A1 | Solute carrier organic anion transporter family member 2A1 | substrate | transporters |