Molecule Details
| InChIKey | YZFWTZACSRHJQD-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CC1(COc2ccc(CC3SC(=O)NC3=O)cc2)CCCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.86 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB09201 |
|---|---|
| Drug Name | Ciglitazone |
| CAS Number | 74772-77-3 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Developed by Takeda Pharmaceuticals in the early 1980s, it is considered the prototypical compound for the thiazolidinedione class. Ciglitazone was never used as a medication, but it sparked interest in the effects of thiazolidinediones. Several analogues were later developed, some of which—such as ... |
Categories: Blood Glucose Lowering Agents Cytochrome P-450 CYP2C8 Inhibitors Cytochrome P-450 CYP2C8 Inhibitors (strength unknown) Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Sulfur Compounds Thiazoles Thiazolidinediones
Cross-references: BindingDB: 50103636 ChEBI: 64227 CHEMBL7002 ChemSpider: 2648 D03493 PubChem:2750 PubChem:310265109 Wikipedia: Ciglitazone