Molecule Details
| InChIKey | YXVDEILMUVTDMK-JKSUJKDBSA-N |
|---|---|
| Compound Name | Pan-FGFR Inhibitor KIN-3248 |
| Canonical SMILES | C=CC(=O)N1C[C@@H](n2nc(C#Cc3c(F)cc4c(ncn4C4CC4)c3F)c(C(N)=O)c2NC)C[C@@H]1COC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.07 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21664 |
|---|---|
| Drug Name | Resigratinib |
| CAS Number | 2750709-91-0 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Resigratinib is a small molecule drug. The usage of the INN stem '-gratinib' in the name indicates that Resigratinib is a fibroblast growth factor receptor (FGFR) inhibitor. Resigratinib has a monoisotopic molecular weight of 523.21 Da. |
Cross-references: BindingDB: 555909 CHEMBL5314537