Molecule Details
| InChIKey | YPELFRMCRYSPKZ-UHFFFAOYSA-N |
|---|---|
| Compound Name | Mosapride |
| Canonical SMILES | CCOc1cc(N)c(Cl)cc1C(=O)NCC1CN(Cc2ccc(F)cc2)CCO1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 9 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.36 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11675 |
|---|---|
| Drug Name | Mosapride |
| CAS Number | 112885-41-3 |
| Groups | investigational |
| ATC Codes | A03FA09 |
| Description | Mosapride is under investigation for the treatment and prevention of Postoperative Ileus and Gastric Peroral Endoscopic Pyloromyotomy (G-POEM). Mosapride has been investigated for the treatment and diagnostic of Constipation, Type 2 Diabetes, Functional Dyspepsia, Functional Constipation, and Epigas... |
Categories: Acids, Carbocyclic Alimentary Tract and Metabolism Amides Anti-Ulcer Agents Antidepressive Agents Benzene Derivatives Benzoates Central Nervous System Depressants Drugs for Functional Gastrointestinal Disorders Gastrointestinal Agents Neurotransmitter Agents Oxazines Propulsives Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin Agents Serotonin Receptor Agonists
Cross-references: BindingDB: 94630 ChEBI: 167204 CHEMBL60889 ChemSpider: 106780 PubChem:119584 PubChem:347828043 RxCUI: 135091 Wikipedia: Mosapride
Target Activities (9)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q13639 | HTR4 | Homo sapiens | Human | PF00001 | 6.8 | Ki | BindingDB |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 6.7 | IC50 | ChEMBL |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 6.6 | IC50 | ChEMBL |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.5 | IC50 | ChEMBL |
| P05177 | CYP1A2 | Homo sapiens | Human | PF00067 | 6.4 | IC50 | ChEMBL |
| P08684 | CYP3A4 | Homo sapiens | Human | PF00067 | 6.2 | IC50 | ChEMBL |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
| P11712 | CYP2C9 | Homo sapiens | Human | PF00067 | 6.0 | IC50 | ChEMBL |
| P33261 | CYP2C19 | Homo sapiens | Human | PF00067 | 6.0 | IC50 | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q13639 | HTR4 | 5-hydroxytryptamine receptor 4 | agonist | targets |