Molecule Details
| InChIKey | YNBHAPKHWDNTMZ-QGZVFWFLSA-N |
|---|---|
| Canonical SMILES | CCOC(=O)CN1CCN(C[C@@H]2CN(c3ccc(C(=N)NC(=O)OC)cc3)C(=O)O2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.1 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20951 |
|---|---|
| Drug Name | Gantofiban |
| CAS Number | 183547-57-1 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Gantofiban is a small molecule drug. The usage of the INN stem '-fiban' in the name indicates that Gantofiban is a fibrinogen receptor antagonist (glycoprotein IIb/IIIa receptor antagonist). Gantofiban has a monoisotopic molecular weight of 447.21 Da. |
Cross-references: BindingDB: 50092103 CHEMBL78871