Molecule Details
| InChIKey | YMTINGFKWWXKFG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Fenofibrate |
| Canonical SMILES | CC(C)OC(=O)C(C)(C)Oc1ccc(C(=O)c2ccc(Cl)cc2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.68 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01039 |
|---|---|
| Drug Name | Fenofibrate |
| CAS Number | 49562-28-9 |
| Groups | approved investigational |
| ATC Codes | C10BA03 C10BA12 C10AB05 C10BA09 C10BA04 |
| Description | Fenofibrate is a fibric acid derivative like [clofibrate] and [gemfibrozil].[A185954] Fenofibrate is used to treat primary hypercholesterolemia, mixed dyslipidemia, severe hypertriglyceridemia.[L8588,L8591] Fenofibrate was granted FDA approval on 31 December 1993.[L8585] |
Categories: Acids, Acyclic Agents Causing Muscle Toxicity BSEP/ABCB11 Substrates Benzene Derivatives Benzophenones Butyrates Cytochrome P-450 CYP2A6 Inhibitors Cytochrome P-450 CYP2A6 Inhibitors (weak) Cytochrome P-450 CYP2C19 Inhibitors Cytochrome P-450 CYP2C19 Inhibitors (weak) Cytochrome P-450 CYP2C8 Inhibitors Cytochrome P-450 CYP2C8 Inhibitors (weak) Cytochrome P-450 CYP2C9 Inhibitors Cytochrome P-450 CYP2C9 Inhibitors (strength unknown) Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A4 Substrates (strength unknown) Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted Ethers Fatty Acids Fatty Acids, Volatile Fibric Acid Derivatives Fibric Acids Hypolipidemic Agents Hypolipidemic Agents Indicated for Hyperlipidemia Isobutyrates Ketones Lipid Modifying Agents Lipid Modifying Agents, Plain Lipid Regulating Agents Lipids Non-statin Hypolipidemic Agents Indicated for Hyperlipidemia Noxae P-glycoprotein inhibitors Peroxisome Proliferator Receptor alpha Agonist Peroxisome Proliferator-activated Receptor alpha Agonists Phenols Phenyl Ethers Toxic Actions UGT1A9 Substrates
Cross-references: BindingDB: 50085042 ChEBI: 5001 CHEMBL672 ChemSpider: 3222 Drugs Product Database (DPD): 1381 C07586 D00565 PDB: J3O PharmGKB: PA449594 PubChem:3339 PubChem:46507371 RxCUI: 8703 Therapeutic Targets Database: DAP000270 Wikipedia: Fenofibrate ZINC: ZINC000000584092
Target Activities (3)
DrugBank Target Actions (16)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | inhibitor | enzymes |
| P11509 | CYP2A6 | Cytochrome P450 2A6 | inhibitor | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | inhibitor | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | inhibitor | enzymes |
| O60656 | O60656 | UDP-glucuronosyltransferase 1A9 | substrate | enzymes |
| P15121 | AKR1B1 | Aldo-keto reductase family 1 member B1 | substrate | enzymes |
| P16152 | CBR1 | Carbonyl reductase [NADPH] 1 | substrate | enzymes |
| P23141 | CES1 | Liver carboxylesterase 1 | substrate | enzymes |
| P42330 | AKR1C3 | Aldo-keto reductase family 1 member C3 | substrate | enzymes |
| P52895 | AKR1C2 | Aldo-keto reductase family 1 member C2 | substrate | enzymes |
| Q04828 | AKR1C1 | Aldo-keto reductase family 1 member C1 | substrate | enzymes |
| Q07869 | PPARA | Peroxisome proliferator-activated receptor alpha | agonist | targets |
| Q9NPA2 | MMP25 | Matrix metalloproteinase-25 | inhibitor | targets |
| O75469 | NR1I2 | Nuclear receptor subfamily 1 group I member 2 | partial agonist | targets |
| O95342 | ABCB11 | Bile salt export pump | substrate | transporters |