Molecule Details
| InChIKey | YLXDSYKOBKBWJQ-LBPRGKRZSA-N |
|---|---|
| Canonical SMILES | CCC(=O)NCC[C@@H]1CCc2ccc3c(c21)CCO3 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 10.61 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00980 |
|---|---|
| Drug Name | Ramelteon |
| CAS Number | 196597-26-9 |
| Groups | approved investigational |
| ATC Codes | N05CH02 |
| Description | Ramelteon is the first in a new class of sleep agents that selectively binds to the melatonin receptors in the suprachiasmatic nucleus (SCN). It is used for insomnia, particularly delayed sleep onset. Ramelteon has not been shown to produce dependence and has shown no potential for abuse. |
Categories: Central Nervous System Depressants Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2C19 Substrates Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted Hypnotics and Sedatives Melatonin Receptor Agonists Nervous System Psycholeptics
Cross-references: BindingDB: 50118470 ChEBI: 109549 CHEMBL1218 ChemSpider: 181000 Guide to Pharmacology: 1356 IUPHAR: 1356 PDB: JEV PharmGKB: PA164744896 PubChem:208902 PubChem:46505923 RxCUI: 596205 Therapeutic Targets Database: DAP000070 Wikipedia: Ramelteon ZINC: ZINC000003960338
Target Activities (2)
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P33261 | CYP2C19 | Cytochrome P450 2C19 | substrate | enzymes |
| P48039 | MTNR1A | Melatonin receptor type 1A | multitarget | targets |
| P49286 | MTNR1B | Melatonin receptor type 1B | multitarget | targets |