Molecule Details
| InChIKey | YKJYKKNCCRKFSL-RDBSUJKOSA-N |
|---|---|
| Compound Name | Anisomycin |
| Canonical SMILES | COc1ccc(C[C@H]2NC[C@H](O)[C@H]2OC(C)=O)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.54 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB07374 |
|---|---|
| Drug Name | Anisomycin |
| CAS Number | 22862-76-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Anisomycin (sometimes known as flagecidin), is an antibiotic retrieved from the bacteria _Streptomyces griseolus_. This drug acts to inhibit bacterial protein and DNA synthesis. |
Categories: Anti-Bacterial Agents Anti-Infective Agents Antiparasitic Agents Antiprotozoals Enzyme Inhibitors Nucleic Acid Synthesis Inhibitors Protein Synthesis Inhibitors Pyrrolidines
Cross-references: BindingDB: 63919 ChEBI: 338412 CHEMBL423192 ChemSpider: 222267 C11281 PDB: ANM PubChem:253602 PubChem:99443845 Wikipedia: Anisomycin ZINC: ZINC000000000954
Target Activities (3)
DrugBank Target Actions (13)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P39023 | RPL3 | Large ribosomal subunit protein uL3 | binder | targets |
| P40429 | RPL13A | Large ribosomal subunit protein uL13 | binder | targets |
| P55769 | P55769 | NHP2-like protein 1 | binder | targets |
| P61313 | RPL15 | Large ribosomal subunit protein eL15 | binder | targets |
| P61927 | RPL37 | Large ribosomal subunit protein eL37 | binder | targets |
| P62750 | RPL23A | Large ribosomal subunit protein uL23 | binder | targets |
| P62829 | RPL23 | Large ribosomal subunit protein uL14 | binder | targets |
| P62913 | RPL11 | Large ribosomal subunit protein uL5 | binder | targets |
| P62917 | RPL8 | Large ribosomal subunit protein uL2 | binder | targets |
| P84098 | RPL19 | Large ribosomal subunit protein eL19 | binder | targets |
| Q96L21 | Q96L21 | Ribosomal protein uL16-like | binder | targets |
| Q9UHA3 | Q9UHA3 | Probable ribosome biogenesis protein RLP24 | binder | targets |
| Q9UNX3 | Q9UNX3 | Ribosomal protein uL24-like | binder | targets |