Molecule Details
| InChIKey | YEESKJGWJFYOOK-IJHYULJSSA-N |
|---|---|
| Compound Name | Leukotriene D4 |
| Canonical SMILES | CCCCC/C=C\C/C=C\C=C\C=C\[C@@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.82 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11858 |
|---|---|
| Drug Name | Leukotriene D4 |
| CAS Number | 73836-78-9 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Leukotriene D4 has been used in trials studying the diagnostic of Asthma and Allergic Rhinitis. |
Categories: Arachidonic Acids Autacoids Biological Factors Eicosanoids Fatty Acids Fatty Acids, Essential Fatty Acids, Unsaturated Inflammation Mediators Leukotrienes Lipids SRS-A
Cross-references: BindingDB: 50292408 ChEBI: 28666 CHEMBL288943 ChemSpider: 4444401 C05951 PDB: LTD PubChem:5280878 PubChem:347828197 Wikipedia: Leukotriene_D4 ZINC: ZINC000004632133