Molecule Details
| InChIKey | YECBIJXISLIIDS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pyrilamine |
| Canonical SMILES | COc1ccc(CN(CCN(C)C)c2ccccn2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.78 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06691 |
|---|---|
| Drug Name | Mepyramine |
| CAS Number | 91-84-9 |
| Groups | approved vet_approved |
| ATC Codes | D04AA02 R06AC01 |
| Description | Mepyramine, or pyrilamine, targets the H1 receptor. It is a first generation antihistamine. However, it rapidly permeates the brain and so often causes drowsiness as a side effect. It has been found in over-the-counter combination products for colds and menstrual symptoms, but is considered to be an... |
Categories: Amines Aminopyridines Anti-Allergic Agents Antihistamines for Systemic Use Antihistamines for Topical Use Antipruritics, Incl. Antihistamines, Anesthetics, Etc. Central Nervous System Agents Central Nervous System Depressants Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (strength unknown) Cytochrome P-450 Enzyme Inhibitors Dermatologicals Histamine Agents Histamine Antagonists Histamine H1 Antagonists Hypnotics and Sedatives Neurotransmitter Agents Potential QTc-Prolonging Agents Pyridines QTc Prolonging Agents Sleep Aids, Pharmaceutical Substituted Ethylene Diamines
Cross-references: BindingDB: 22567 ChEBI: 6762 CHEMBL511 ChemSpider: 4818 Drugs Product Database (DPD): 7155 C11798 D08183 PDB: Y5E PharmGKB: PA165817939 PubChem:4992 PubChem:175427084 RxCUI: 9009 Wikipedia: Mepyramine ZINC: ZINC000019144216
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 8.7 | Ki | ChEMBL;BindingDB |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 7.5 | IC50 | ChEMBL |
| P10635 | CYP2D6 | Homo sapiens | Human | PF00067 | 6.5 | IC50 | ChEMBL |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 6.3 | IC50 | ChEMBL |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 6.2 | Ki | ChEMBL |
| Q01959 | SLC6A3 | Homo sapiens | Human | PF00209 | 6.1 | IC50 | ChEMBL |