Molecule Details
| InChIKey | YDPWZFPXWFTXNT-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | COc1ccc(NC(=O)c2n[nH]c3ccc(-c4cncc(CN5CCCCC5)c4)cc23)cn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.2 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21475 |
|---|---|
| Drug Name | Teplinovivint |
| CAS Number | 1428064-91-8 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Teplinovivint is a small molecule drug. The usage of the INN stem '-vivint' in the name indicates that Teplinovivint is a Wnt signaling inhibitor. Teplinovivint has a monoisotopic molecular weight of 442.21 Da. |
Cross-references: BindingDB: 445772 CHEMBL4800084