Molecule Details
| InChIKey | YDBLKRPLXZNVNB-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | Cc1cc(SCc2sc(-c3ccc(C(F)(F)F)cc3)nc2C)ccc1OCC(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.32 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05416 |
|---|---|
| Drug Name | Cardarine |
| CAS Number | 317318-70-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Cardarine (GW-501516) is a peroxisome proliferator-activator receptor-delta agonist for the potential treatment of dyslipidemia. Cardarine has been investigated for the treatment of Obesity, Lipid Disorders, and Cardiovascular Disease. |
Categories: Sulfur Compounds
Cross-references: BindingDB: 28661 ChEBI: 73726 CHEMBL38943 ChemSpider: 7979723 PDB: 7T1 PubChem:9803963 PubChem:175426999 Wikipedia: GW501516 ZINC: ZINC000001549989