Molecule Details
| InChIKey | YCHYFHOSGQABSW-RTBURBONSA-N |
|---|---|
| Canonical SMILES | CCCCCCC(C)(C)c1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC=C(C(=O)O)C[C@@H]21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.31 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12193 |
|---|---|
| Drug Name | Lenabasum |
| CAS Number | 137945-48-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Ajulemic acid has been used in trials studying the treatment of Cystic Fibrosis, Dermatomyositis, and Diffuse Cutaneous Systemic Sclerosis. |
Categories: Agents producing tachycardia Cannabinoid Receptor Agonists Cannabinoids and similars Hormones Hormones, Hormone Substitutes, and Hormone Antagonists Neurotransmitter Agents Terpenes Tumor Necrosis Factor Blockers
Cross-references: BindingDB: 50005920 CHEMBL456341 ChemSpider: 2340729 PDB: AJA PubChem:3083542 PubChem:347828478 Wikipedia: Ajulemic_acid ZINC: ZINC000001905712
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P01375 | TNF | Tumor necrosis factor | inhibitor | targets |