Molecule Details
| InChIKey | YBWLTKFZAOSWSM-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | COc1ccccc1Oc1c(NS(=O)(=O)c2ccc(C)cn2)nc(-c2ccncc2)nc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.45 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20899 |
|---|---|
| Drug Name | Avosentan |
| CAS Number | 290815-26-8 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Avosentan is a small molecule drug. The usage of the INN stem '-entan' in the name indicates that Avosentan is a endothelin receptor antagonist. Avosentan has a monoisotopic molecular weight of 479.13 Da. |
Cross-references: BindingDB: 50532577 CHEMBL3989834 ZINC: ZINC000000602818
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P25101 | EDNRA | Endothelin-1 receptor | antagonist | targets |