Molecule Details
| InChIKey | YBBUGSYNPXTSGW-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CN(C)Cc1cncc(-c2cnc3[nH]nc(-c4nc5c(-c6cccc(F)c6)cncc5[nH]4)c3c2)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.12 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21479 |
|---|---|
| Drug Name | Ipivivint |
| CAS Number | 1481617-15-5 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Ipivivint is a small molecule drug. The usage of the INN stem '-vivint' in the name indicates that Ipivivint is a Wnt signaling inhibitor. Ipivivint has a monoisotopic molecular weight of 464.19 Da. |
Cross-references: BindingDB: 270451 CHEMBL4740064