Molecule Details
| InChIKey | YBAWYTYNMZWMMJ-UHFFFAOYSA-N |
|---|---|
| Compound Name | Idalopirdine |
| Canonical SMILES | Fc1ccc2c(CCNCc3cccc(OCC(F)(F)C(F)F)c3)c[nH]c2c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.26 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11957 |
|---|---|
| Drug Name | Idalopirdine |
| CAS Number | 467459-31-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Idalopirdine has been used in trials studying the treatment of Cognition, Schizophrenia, and Alzheimer's Disease. |
Categories: Amines Antidepressive Agents Benzene Derivatives Benzyl Compounds Central Nervous System Depressants Heterocyclic Compounds, Fused-Ring Hydrocarbons, Fluorinated Hydrocarbons, Halogenated Neurotransmitter Agents Serotonin Agents Serotonin Receptor Antagonists
Cross-references: BindingDB: 50019754 CHEMBL3286580 ChemSpider: 19878969 PubChem:21071390 PubChem:347828282 Wikipedia: Idalopirdine ZINC: ZINC000095936819