Molecule Details
| InChIKey | YASAKCUCGLMORW-UHFFFAOYSA-N |
|---|---|
| Compound Name | Rosiglitazone |
| Canonical SMILES | CN(CCOc1ccc(CC2SC(=O)NC2=O)cc1)c1ccccn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.62 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00412 |
|---|---|
| Drug Name | Rosiglitazone |
| CAS Number | 122320-73-4 |
| Groups | approved investigational |
| ATC Codes | A10BD04 A10BG02 A10BD03 |
| Description | Rosiglitazone is an anti-diabetic drug in the thiazolidinedione class of drugs. It is marketed by the pharmaceutical company GlaxoSmithKline as a stand-alone drug (Avandia) and in combination with metformin (Avandamet) or with glimepiride (Avandaryl). Like other thiazolidinediones, the mechanism of ... |
Categories: Alimentary Tract and Metabolism BSEP/ABCB11 Substrates Blood Glucose Lowering Agents Cytochrome P-450 CYP1A2 Inhibitors Cytochrome P-450 CYP1A2 Inhibitors (strength unknown) Cytochrome P-450 CYP2B6 Inducers Cytochrome P-450 CYP2B6 Inducers (strength unknown) Cytochrome P-450 CYP2C8 Inhibitors Cytochrome P-450 CYP2C8 Inhibitors (moderate) Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 CYP2C9 Inhibitors Cytochrome P-450 CYP2C9 Inhibitors (strength unknown) Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (strength unknown) Cytochrome P-450 CYP2E1 Substrates Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strength unknown) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Enzyme Inducers Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs Used in Diabetes Drugs that are Mainly Renally Excreted Hypoglycemia-Associated Agents NTCP Inhibitors OATP1B1/SLCO1B1 Inhibitors Oral Hypoglycemics Peroxisome Proliferator Receptor gamma Agonist Peroxisome Proliferator-activated Receptor Activity Sulfur Compounds Thiazoles Thiazolidinediones Vasodilating Agents
Cross-references: BindingDB: 723998 ChEBI: 50122 CHEMBL121 ChemSpider: 70383 Drugs Product Database (DPD): 11925 Guide to Pharmacology: 1056 IUPHAR: 1056 D00596 PDB: BRL PharmGKB: PA451283 PubChem:77999 PubChem:46504556 RxCUI: 84108 Therapeutic Targets Database: DAP000271 Wikipedia: Rosiglitazone
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P37231 | PPARG | Homo sapiens | Human | PF00104 PF12577 PF00105 | 7.1 | IC50 | ChEMBL;BindingDB |
| Q15596 | NCOA2 | Homo sapiens | Human | PF23172 PF07469 PF16279 PF16665 PF08815 PF00989 PF14598 PF08832 | 6.9 | IC50 | BindingDB |
| Q9NZ45 | CISD1 | Homo sapiens | Human | PF10660 PF09360 | 6.8 | IC50 | ChEMBL |
| P19793 | RXRA | Homo sapiens | Human | PF00104 PF11825 PF00105 | 6.2 | Kd | ChEMBL |
| P27338 | MAOB | Homo sapiens | Human | PF01593 | 6.1 | IC50 | ChEMBL |
DrugBank Target Actions (18)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | substrate | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| P20813 | CYP2B6 | Cytochrome P450 2B6 | inducer | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | inhibitor | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | inhibitor | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | inhibitor | enzymes |
| P05181 | CYP2E1 | Cytochrome P450 2E1 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | substrate | enzymes |
| P37231 | PPARG | Peroxisome proliferator-activated receptor gamma | agonist | targets |
| O60488 | O60488 | Long-chain-fatty-acid--CoA ligase 4 | inhibitor | targets |
| P19793 | RXRA | Retinoic acid receptor RXR-alpha | inhibitor | targets |
| Q14973 | SLC10A1 | Hepatic sodium/bile acid cotransporter | inhibitor | transporters |
| Q9Y6L6 | SLCO1B1 | Solute carrier organic anion transporter family member 1B1 | inhibitor | transporters |
| O95342 | ABCB11 | Bile salt export pump | substrate | transporters |