Molecule Details
| InChIKey | XVGOZDAJGBALKS-UHFFFAOYSA-N |
|---|---|
| Compound Name | Blonanserin |
| Canonical SMILES | CCN1CCN(c2cc(-c3ccc(F)cc3)c3c(n2)CCCCCC3)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.47 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB09223 |
|---|---|
| Drug Name | Blonanserin |
| CAS Number | 132810-10-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Blonanserin is an atypical antipsychotic approved in Japan in January, 2008. It offers improved tolerability as it lacks side effects such as extrapyramidal symptoms, excessive sedation, or hypotension. As a second-generation (atypical) antipsychotic, it is significantly more efficacious in the trea... |
Categories: Antidepressive Agents Antipsychotic Agents Antipsychotic Agents (Second Generation [Atypical]) Central Nervous System Depressants Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Dopamine Antagonists Dopamine D2 Receptor Antagonists Drugs that are Mainly Renally Excreted Neurotoxic agents Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 5-HT2 Receptor Antagonists Serotonin 5-HT2A Receptor Antagonists Serotonin Agents Serotonin Receptor Antagonists
Cross-references: BindingDB: 50160807 ChEBI: 31296 CHEMBL178803 ChemSpider: 111697 D01176 PubChem:125564 PubChem:310265129 Wikipedia: Blonanserin ZINC: ZINC000000597434