Molecule Details
| InChIKey | XUTLOCQNGLJNSA-RGVLZGJSSA-N |
|---|---|
| Canonical SMILES | CC(C)(C)N/C(=N\C#N)Nc1cccc(/C(=C\CCCC(=O)O)c2cccnc2)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.18 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12204 |
|---|---|
| Drug Name | Terbogrel |
| CAS Number | 149979-74-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Terbogrel has been used in trials studying the treatment of Hypertension, Pulmonary. |
Cross-references: CHEMBL281398 ChemSpider: 4952549 PubChem:6449876 PubChem:347828488 Wikipedia: Terbogrel ZINC: ZINC000011726169
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P21731 | TBXA2R | Thromboxane A2 receptor | antagonist | targets |