Molecule Details
| InChIKey | XTKDAFGWCDAMPY-UHFFFAOYSA-N |
|---|---|
| Compound Name | Azaperone |
| Canonical SMILES | O=C(CCCN1CCN(c2ccccn2)CC1)c1ccc(F)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.22 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11376 |
|---|---|
| Drug Name | Azaperone |
| CAS Number | 1649-18-9 |
| Groups | investigational vet_approved |
| ATC Codes | nan |
| Description | Azaperone is a pyridinylpiperazine and butyrophenone agent that is capable of eliciting neuroleptic sedative and antiemetic effects. It is subsequently employed predominantly as a veterinary tranquilizer and mainly for pigs and elephants. At the same time, the agent generally does not see equine use... |
Categories: Antipsychotic Agents Antipsychotic Agents (First Generation [Typical]) Butyrophenones Central Nervous System Agents Central Nervous System Depressants Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists Hypnotics and Sedatives Ketones Neurotoxic agents Neurotransmitter Agents Psychotropic Drugs Tranquilizing Agents
Cross-references: BindingDB: 50036733 ChEBI: 88301 CHEMBL340211 ChemSpider: 14695 Drugs Product Database (DPD): 7972 D02620 RxCUI: 2601502 Wikipedia: Azaperone ZINC: ZINC000002596977
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 8.2 | Ki | ChEMBL;BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 8.1 | Ki | ChEMBL;BindingDB |
| Q5BJF2 | TMEM97 | Homo sapiens | Human | PF05241 | 7.3 | Ki | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 7.2 | Ki | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 7.0 | Ki | ChEMBL;BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 6.9 | Ki | ChEMBL;BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 6.6 | Ki | ChEMBL;BindingDB |
| Q99720 | SIGMAR1 | Homo sapiens | Human | PF04622 | 6.4 | Ki | ChEMBL;BindingDB |