Molecule Details
| InChIKey | XSDQTOBWRPYKKA-UHFFFAOYSA-N |
|---|---|
| Compound Name | Amiloride |
| Canonical SMILES | N=C(N)NC(=O)c1nc(Cl)c(N)nc1N |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.11 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00594 |
|---|---|
| Drug Name | Amiloride |
| CAS Number | 2609-46-3 |
| Groups | approved investigational |
| ATC Codes | C03DB01 |
| Description | A pyrazine compound inhibiting sodium reabsorption through sodium channels in renal epithelial cells. This inhibition creates a negative potential in the luminal membranes of principal cells, located in the distal convoluted tubule and collecting duct. Negative potential reduces secretion of potassi... |
Categories: Acid Sensing Ion Channel Blockers Agents causing hyperkalemia Cardiovascular Agents Decreased Renal K+ Excretion Diuretics Epithelial Sodium Channel Blockers Hypotensive Agents Increased Diuresis Membrane Transport Modulators Natriuretic Agents OCT2 Inhibitors Potassium-Sparing Diuretics Pyrazines Sodium Channel Blockers
Cross-references: BindingDB: 16173 ChEBI: 2639 CHEMBL945 ChemSpider: 15403 Drugs Product Database (DPD): 20230 Guide to Pharmacology: 2421 IUPHAR: 2421 C06821 D07447 PDB: AMR PharmGKB: PA448368 PubChem:16231 PubChem:46508156 RxCUI: 644 Therapeutic Targets Database: DAP000187 Wikipedia: Amiloride ZINC: ZINC000004340269
Target Activities (2)
DrugBank Target Actions (13)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P19801 | AOC1 | Diamine oxidase [copper-containing] | inhibitor | enzymes |
| Q9TRC7 | Q9TRC7 | Diamine oxidase [copper-containing] | inhibitor | enzymes |
| P00749 | PLAU | Urokinase-type plasminogen activator | inhibitor | targets |
| P19634 | SLC9A1 | Sodium/hydrogen exchanger 1 | inhibitor | targets |
| P19801 | AOC1 | Diamine oxidase [copper-containing] | inhibitor | targets |
| P37088 | SCNN1A | Epithelial sodium channel subunit alpha | inhibitor | targets |
| P51168 | SCNN1B | Epithelial sodium channel subunit beta | inhibitor | targets |
| P51170 | SCNN1G | Epithelial sodium channel subunit gamma | inhibitor | targets |
| P51172 | P51172 | Epithelial sodium channel subunit delta | inhibitor | targets |
| P78348 | ASIC1 | Acid-sensing ion channel 1 | inhibitor | targets |
| Q16515 | Q16515 | Acid-sensing ion channel 2 | inhibitor | targets |
| O15244 | SLC22A2 | Solute carrier family 22 member 2 | inhibitor | transporters |
| Q9H015 | Q9H015 | Solute carrier family 22 member 4 | inhibitor | transporters |