Molecule Details
| InChIKey | XMBUPPIEVAFYHO-KPZWWZAWSA-N |
|---|---|
| Canonical SMILES | Cc1c(N[C@@H](c2nnc(-c3ccc(C#N)cc3)o2)[C@H](C)O)ccc(C#N)c1Cl |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.13 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13939 |
|---|---|
| Drug Name | Vosilasarm |
| CAS Number | 1182367-47-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | RAD140 is an investigational selective androgen receptor modulator (SARM) for the treatment of conditions such as muscle wasting and breast cancer. |
Categories: Oxazoles
Cross-references: BindingDB: 50336997 CHEMBL1672635 ChemSpider: 26387625 Wikipedia: RAD140 ZINC: ZINC000066097792
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P10275 | AR | Androgen receptor | modulator | targets |