Molecule Details
| InChIKey | XJGVXQDUIWGIRW-UHFFFAOYSA-N |
|---|---|
| Compound Name | Loxapine |
| Canonical SMILES | CN1CCN(C2=Nc3ccccc3Oc3ccc(Cl)cc32)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 17 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.35 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00408 |
|---|---|
| Drug Name | Loxapine |
| CAS Number | 1977-10-2 |
| Groups | approved investigational |
| ATC Codes | N05AH01 |
| Description | An antipsychotic agent used in schizophrenia. [PubChem] |
Categories: Antidepressive Agents Antipsychotic Agents Antipsychotic Agents (First Generation [Typical]) Central Nervous System Agents Central Nervous System Depressants Diazepines, Oxazepines, Thiazepines and Oxepines Dibenzoxazepines Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists Drugs causing inadvertant photosensitivity Heterocyclic Compounds, Fused-Ring Miscellaneous Antipsychotics Nervous System Neurotoxic agents Neurotransmitter Agents P-glycoprotein inhibitors Photosensitizing Agents Psycholeptics Psychotropic Drugs Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 5-HT2 Receptor Antagonists Serotonin 5-HT2A Receptor Antagonists Serotonin 5-HT2C Receptor Antagonists Serotonin Agents Serotonin Receptor Antagonists Tranquilizing Agents
Cross-references: BindingDB: 22871 ChEBI: 50841 CHEMBL831 ChemSpider: 3827 Drugs Product Database (DPD): 2189 Guide to Pharmacology: 205 IUPHAR: 205 C07104 D02340 PharmGKB: PA450273 PubChem:3964 PubChem:46505047 RxCUI: 6475 Therapeutic Targets Database: DAP000311 Wikipedia: Loxapine ZINC: ZINC000019796158
Target Activities (17)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 8.6 | Ki | ChEMBL;BindingDB |
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 8.3 | Ki | BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 8.1 | Ki | ChEMBL;BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 8.0 | Ki | BindingDB |
| P50406 | HTR6 | Homo sapiens | Human | PF00001 | 7.7 | Ki | ChEMBL;BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 7.7 | Ki | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 7.7 | IC50 | ChEMBL;BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 7.5 | Ki | BindingDB |
| P11229 | CHRM1 | Homo sapiens | Human | PF00001 | 7.2 | Ki | BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 7.1 | Ki | BindingDB |
| P34969 | HTR7 | Homo sapiens | Human | PF00001 | 7.1 | Ki | BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 7.0 | Ki | BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.8 | Ki | BindingDB |
| P20309 | CHRM3 | Homo sapiens | Human | PF00001 | 6.7 | Ki | BindingDB |
| P08912 | CHRM5 | Homo sapiens | Human | PF00001 | 6.6 | Ki | BindingDB |
| P08173 | CHRM4 | Homo sapiens | Human | PF00001 | 6.5 | Ki | BindingDB |
| P08172 | CHRM2 | Homo sapiens | Human | PF00001 | 6.3 | Ki | BindingDB |
DrugBank Target Actions (33)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P21728 | DRD1 | D(1A) dopamine receptor | antagonist | targets |
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | antagonist | targets |
| P28335 | HTR2C | 5-hydroxytryptamine receptor 2C | antagonist | targets |
| P08172 | CHRM2 | Muscarinic acetylcholine receptor M2 | binder | targets |
| P08173 | CHRM4 | Muscarinic acetylcholine receptor M4 | binder | targets |
| P08588 | ADRB1 | Beta-1 adrenergic receptor | binder | targets |
| P08908 | HTR1A | 5-hydroxytryptamine receptor 1A | binder | targets |
| P08912 | CHRM5 | Muscarinic acetylcholine receptor M5 | binder | targets |
| P08913 | ADRA2A | Alpha-2A adrenergic receptor | binder | targets |
| P11229 | CHRM1 | Muscarinic acetylcholine receptor M1 | binder | targets |
| P18089 | ADRA2B | Alpha-2B adrenergic receptor | binder | targets |
| P18825 | ADRA2C | Alpha-2C adrenergic receptor | binder | targets |
| P20309 | CHRM3 | Muscarinic acetylcholine receptor M3 | binder | targets |
| P21728 | DRD1 | D(1) dopamine receptor | binder | targets |
| P21917 | DRD4 | D(4) dopamine receptor | binder | targets |
| P21918 | DRD5 | D(1B) dopamine receptor | binder | targets |
| P23975 | SLC6A2 | Sodium-dependent noradrenaline transporter | binder | targets |
| P25021 | HRH2 | Histamine H2 receptor | binder | targets |
| P28221 | HTR1D | 5-hydroxytryptamine receptor 1D | binder | targets |
| P28222 | HTR1B | 5-hydroxytryptamine receptor 1B | binder | targets |
| P28566 | HTR1E | 5-hydroxytryptamine receptor 1E | binder | targets |
| P31645 | SLC6A4 | Sodium-dependent serotonin transporter | binder | targets |
| P34969 | HTR7 | 5-hydroxytryptamine receptor 7 | binder | targets |
| P35348 | ADRA1A | Alpha-1A adrenergic receptor | binder | targets |
| P35367 | HRH1 | Histamine H1 receptor | binder | targets |
| P35368 | ADRA1B | Alpha-1B adrenergic receptor | binder | targets |
| P35462 | DRD3 | D(3) dopamine receptor | binder | targets |
| P46098 | HTR3A | 5-hydroxytryptamine receptor 3A | binder | targets |
| P47898 | HTR5A | 5-hydroxytryptamine receptor 5A | binder | targets |
| P50406 | HTR6 | 5-hydroxytryptamine receptor 6 | binder | targets |
| Q01959 | SLC6A3 | Sodium-dependent dopamine transporter | binder | targets |
| Q9H3N8 | HRH4 | Histamine H4 receptor | binder | targets |