Molecule Details
| InChIKey | XDHNQDDQEHDUTM-JQWOJBOSSA-N |
|---|---|
| Compound Name | Bafilomycin A1 |
| Canonical SMILES | CO/C1=C\C(C)=C\[C@@H](C)[C@@H](O)[C@@H](C)C/C(C)=C/C=C/[C@H](OC)[C@@H]([C@@H](C)[C@@H](O)[C@H](C)[C@@]2(O)C[C@@H](O)[C@H](C)[C@@H](C(C)C)O2)OC1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.56 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06733 |
|---|---|
| Drug Name | Bafilomycin A1 |
| CAS Number | 88899-55-2 |
| Groups | experimental |
| ATC Codes | nan |
| Description | The bafilomycins refer to a category of toxic macrolide antibiotics that are derivatives of Streptomyces griseus. These compounds all appear in the same fermentation and have similar biological activity. Bafilomycins are specific inhibitors of vacuolar-type H+-ATPase. (V-ATPase). The most commonly u... |
Categories: Anti-Infective Agents Antifungal Agents Enzyme Inhibitors Lactones Polyketides Proton-Translocating ATPases, antagonists & inhibitors
Cross-references: BindingDB: 50064186 ChEBI: 22689 CHEMBL290814 ChemSpider: 4642865 PubChem:6436223 PubChem:347827783 Wikipedia: Bafilomycin ZINC: ZINC000169647947
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P38606 | P38606 | V-type proton ATPase catalytic subunit A | inhibitor | targets |