Molecule Details
| InChIKey | XBBRLCXCBCZIOI-DLBZAZTESA-N |
|---|---|
| Canonical SMILES | Nc1nnc(CN[C@@H]2C[C@H]2c2ccc(OCc3ccccc3)cc2)o1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.23 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16446 |
|---|---|
| Drug Name | Vafidemstat |
| CAS Number | 1357362-02-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Vafidemstat is under investigation in clinical trial NCT03867253 (Testing the Safety and Preliminary Efficacy of the New Drug ORY-2001 in Mild to Moderate Alzheimer's Disease). |
Categories: Oxazoles
Cross-references: ChemSpider: 68019508
Target Activities (2)
DrugBank Target Actions (4)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| O60341 | KDM1A | Lysine-specific histone demethylase 1A | binder | targets |
| O60341 | KDM1A | Lysine-specific histone demethylase 1A | inhibitor | targets |
| P27338 | MAOB | Amine oxidase [flavin-containing] B | inhibitor | targets |
| O60341 | KDM1A | Lysine-specific histone demethylase 1A | modulator | targets |