Molecule Details
| InChIKey | XASIMHXSUQUHLV-UHFFFAOYSA-N |
|---|---|
| Compound Name | Camostat |
| Canonical SMILES | CN(C)C(=O)COC(=O)Cc1ccc(OC(=O)c2ccc(NC(=N)N)cc2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.05 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13729 |
|---|---|
| Drug Name | Camostat |
| CAS Number | 59721-28-7 |
| Groups | investigational |
| ATC Codes | B02AB04 |
| Description | Camostat mesylate, or FOY-305, is a synthetic serine protease inhibitor.[A193842,A193848] It was first described in the literature in 1981, as part of research on the inhibition of skin tumors in mice.[A198807] Camostat mesylate inhibits cholecystokinin, pro-inflammatory cytokines, and serine protea... |
Categories: Amidines Antifibrinolytic Agents Blood and Blood Forming Organs Enzyme Inhibitors Guanidines Hemostatics Protease Inhibitors Proteinase Inhibitors Serine Protease Inhibitors Trypsin Inhibitors
Cross-references: BindingDB: 50424712 ChEBI: 135632 CHEMBL590799 ChemSpider: 2440 Wikipedia: Camostat ZINC: ZINC000003871842
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P07478 | PRSS2 | Homo sapiens | Human | PF00089 | 8.6 | IC50 | ChEMBL |
| P35030 | PRSS3 | Homo sapiens | Human | PF00089 | 8.6 | IC50 | ChEMBL |
| P07477 | PRSS1 | Homo sapiens | Human | PF00089 | 8.3 | IC50 | ChEMBL;BindingDB |
| Q8IU80 | TMPRSS6 | Homo sapiens | Human | PF00057 PF01390 PF00089 | 8.2 | Ki | BindingDB |
| P05981 | HPN | Homo sapiens | Human | PF09272 PF00089 | 8.2 | Ki | ChEMBL;BindingDB |
| O15393 | TMPRSS2 | Homo sapiens | Human | PF15494 PF00089 | 8.1 | IC50 | ChEMBL;BindingDB |
| P00734 | F2 | Homo sapiens | Human | PF00594 PF00051 PF09396 PF00089 | 6.2 | IC50 | ChEMBL;BindingDB |