Molecule Details
| InChIKey | WZPBZJONDBGPKJ-VEHQQRBSSA-N |
|---|---|
| Compound Name | Aztreonam |
| Canonical SMILES | C[C@H]1[C@H](NC(=O)/C(=N\OC(C)(C)C(=O)O)c2csc(N)n2)C(=O)N1S(=O)(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.75 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00355 |
|---|---|
| Drug Name | Aztreonam |
| CAS Number | 78110-38-0 |
| Groups | approved investigational |
| ATC Codes | J01DF01 |
| Description | A monocyclic beta-lactam antibiotic originally isolated from Chromobacterium violaceum. It is resistant to beta-lactamases and is used in gram-negative infections, especially of the meninges, bladder, and kidneys. It may cause a superinfection with gram-positive organisms. |
Categories: Amides Anti-Bacterial Agents Anti-Infective Agents Antibacterials for Systemic Use Antiinfectives for Systemic Use Drugs that are Mainly Renally Excreted Heterocyclic Compounds, Fused-Ring Lactams Monobactam Antibacterial Monobactams Sulfur Compounds beta-Lactams
Cross-references: BindingDB: 50240480 ChEBI: 161680 CHEMBL158 ChemSpider: 4674940 Drugs Product Database (DPD): 8325 C06840 D00240 PDB: AZR PharmGKB: PA448523 PubChem:9568617 PubChem:46505419 RxCUI: 1272 Therapeutic Targets Database: DAP000117 Wikipedia: Aztreonam ZINC: ZINC000003830264
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q3S5C3 | sugE | Salmonella newport | Pathogen | PF00893 | 8.2 | IC50 | ChEMBL;BindingDB |
| Q48435 | bla LAT-2 | Klebsiella pneumoniae | Pathogen | PF00144 | 8.2 | IC50 | ChEMBL;BindingDB |
| B2ZTR6 | Acinetobacter baumannii | Pathogen | PF00144 | 8.2 | Ki | ChEMBL;BindingDB | |
| A4ZYU9 | blaACC-4 | Escherichia coli | Pathogen | PF00144 | 7.5 | IC50 | ChEMBL;BindingDB |
| P00811 | ampC | Escherichia coli (strain K12) | Pathogen | PF00144 | 7.2 | IC50 | BindingDB |
| Q51504 | pbpB | Pseudomonas aeruginosa | Pathogen | PF03717 PF00905 | 7.2 | IC50 | BindingDB |