Molecule Details
| InChIKey | WYJCYXOCHXWTHG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Palosuran |
| Canonical SMILES | Cc1cc(NC(=O)NCCN2CCC(O)(Cc3ccccc3)CC2)c2ccccc2n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.5 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21258 |
|---|---|
| Drug Name | Palosuran |
| CAS Number | 540769-28-6 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Palosuran is a small molecule drug. The usage of the INN stem '-osuran' in the name indicates that Palosuran is a urotensin receptor antagonist. Palosuran has a monoisotopic molecular weight of 418.24 Da. |
Categories: Amides Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50302272 CHEMBL567303 ZINC: ZINC000034375693
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q9UKP6 | UTS2R | Homo sapiens | Human | PF00001 | 7.4 | IC50 | ChEMBL;BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.9 | Ki | ChEMBL |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 6.2 | Ki | ChEMBL |
| Q5BJF2 | TMEM97 | Homo sapiens | Human | PF05241 | 6.0 | Ki | ChEMBL |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 6.0 | Ki | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q9UKP6 | UTS2R | Urotensin-2 receptor | inhibitor | targets |