Molecule Details
| InChIKey | WPNJAUFVNXKLIM-UHFFFAOYSA-N |
|---|---|
| Compound Name | Moxonidine |
| Canonical SMILES | COc1nc(C)nc(Cl)c1NC1=NCCN1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.4 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB09242 |
|---|---|
| Drug Name | Moxonidine |
| CAS Number | 75438-57-2 |
| Groups | approved investigational withdrawn |
| ATC Codes | C02AC05 C02LC05 |
| Description | Moxonidine is a new-generation centrally acting antihypertensive drug approved for the treatment of mild to moderate essential hypertension. It is suggested to be effective in cases where other agents such as thiazides, beta-blockers, ACE inhibitors, and calcium channel blockers are not appropriate ... |
Categories: Adrenergic Agonists Adrenergic alpha-2 Receptor Agonists Adrenergic alpha-Agonists Agents producing tachycardia Agents that produce hypertension Antiadrenergic Agents, Centrally Acting Antihypertensive Agents Cardiovascular Agents Hypotensive Agents Imidazoline Receptor Agonists Sympatholytics
Cross-references: BindingDB: 50050093 ChEBI: 7009 CHEMBL19236 ChemSpider: 4645 C07451 D05087 PubChem:4810 PubChem:310265145 RxCUI: 30257 Wikipedia: Moxonidine ZINC: ZINC000001854466