Molecule Details
| InChIKey | WOFMFGQZHJDGCX-ZULDAHANSA-N |
|---|---|
| Compound Name | Mometasone Furoate |
| Canonical SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]2(C)[C@@]1(OC(=O)c1ccco1)C(=O)CCl |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.44 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14512 |
|---|---|
| Drug Name | Mometasone furoate |
| CAS Number | 83919-23-7 |
| Groups | approved investigational vet_approved |
| ATC Codes | D07AC13 R03BA07 D07XC03 R01AD09 R03AK09 |
| Description | Mometasone furoate is a corticosteroid drug that can be used for the treatment of asthma, rhinitis, and certain skin conditions[FDA Label][F4292,F4295]. It has a glucocorticoid receptor binding affinity 22 times stronger than [dexamethasone] and higher than many other corticosteroids as well[A176906... |
Categories: Adrenal Cortex Hormones Adrenals Adrenergics, Inhalants Anti-Allergic Agents Anti-Inflammatory Agents Corticosteroids Corticosteroids, Dermatological Preparations Corticosteroids, Potent (Group III) Cytochrome P-450 CYP2C8 Inhibitors Cytochrome P-450 CYP2C8 Inhibitors (strength unknown) Cytochrome P-450 CYP2C8 Inhibitors (strong) Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strength unknown) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Inducers Cytochrome P-450 CYP3A5 Inducers (strength unknown) Cytochrome P-450 Enzyme Inducers Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Dermatologicals Drugs for Obstructive Airway Diseases Fused-Ring Compounds Glucocorticoids Hyperglycemia-Associated Agents Immunosuppressive Agents Nasal Preparations Pregnadienes Steroids Thyroxine-binding globulin inhibitors
Cross-references: BindingDB: 50148733 ChEBI: 47564 CHEMBL1161 ChemSpider: 390091 Drugs Product Database (DPD): 7504 C07817 D00690 PDB: MOF RxCUI: 30145 Wikipedia: Mometasone ZINC: ZINC000003938677
Target Activities (3)
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | inducer | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P04150 | NR3C1 | Glucocorticoid receptor | agonist | targets |
| P06401 | PGR | Progesterone receptor | modulator | targets |