Molecule Details
| InChIKey | WNMJYKCGWZFFKR-UHFFFAOYSA-N |
|---|---|
| Compound Name | Alfuzosin |
| Canonical SMILES | COc1cc2nc(N(C)CCCNC(=O)C3CCCO3)nc(N)c2cc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.04 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00346 |
|---|---|
| Drug Name | Alfuzosin |
| CAS Number | 81403-80-7 |
| Groups | approved |
| ATC Codes | G04CA01 G04CA51 |
| Description | Benign prostatic hyperplasia (BPH) refers to a benign growth or hyperplasia of the prostate and leads to lower urinary tract symptoms in men, such as urgency, frequency and changes to urine flow. The prevalence of BPH is as high as 50%-60% for males in their 60's, and this prevalence increases to 80... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Drugs Used in Benign Prostatic Hypertrophy Genito Urinary System and Sex Hormones Genitourinary Agents Heterocyclic Compounds, Fused-Ring Neurotransmitter Agents P-glycoprotein substrates Peripheral alpha-1 blockers Potential QTc-Prolonging Agents Prostatic Hyperplasia QTc Prolonging Agents Selective Alfa-1-adrenergic Blocking Agents Urological Agents Urologicals
Cross-references: BindingDB: 50033110 ChEBI: 51141 CHEMBL709 ChemSpider: 2008 Drugs Product Database (DPD): 12699 D07124 PharmGKB: PA164774795 PubChem:2092 PubChem:46508512 RxCUI: 17300 Therapeutic Targets Database: DCL000664 Wikipedia: Alfuzosin
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 8.4 | Ki | ChEMBL;BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 8.0 | Ki | ChEMBL;BindingDB |
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 8.0 | Ki | ChEMBL;BindingDB |
| P22303 | ACHE | Homo sapiens | Human | PF08674 PF00135 | 7.7 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (7)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | Alpha-1-acid glycoprotein 1 | binder | carriers |
| P02768 | ALB | Albumin | binder | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P25100 | ADRA1D | Alpha-1D adrenergic receptor | antagonist | targets |
| P35348 | ADRA1A | Alpha-1 adrenergic receptors | antagonist | targets |
| P35368 | ADRA1B | Alpha-1B adrenergic receptor | antagonist | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |