Molecule Details
| InChIKey | WKTSLVQYGBHNRV-UHFFFAOYSA-N |
|---|---|
| Compound Name | Zelenirstat |
| Canonical SMILES | Cc1c(NS(=O)(=O)c2c(Cl)cc(-c3ccnc(N4CCNCC4)c3)cc2Cl)c(CC(C)C)nn1C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.7 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15567 |
|---|---|
| Drug Name | Zelenirstat |
| CAS Number | 1215011-08-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Zelenirstat (PCLX-001) is a first-in-kind N-Myristoyltransferase (NMT) inhibitor being developed by [Pacylex Pharmaceuticals](https://pacylex.com). Current studies have shown that zelenirstat works differently than other known cancer drugs and has high activity and positive results in breast, lung, ... |
Cross-references: BindingDB: 50033418 CHEMBL3357685 PDB: P3U Wikipedia: Zelenirstat ZINC: ZINC000098209285