Molecule Details
| InChIKey | WKDNQONLGXOZRG-HRNNMHKYSA-N |
|---|---|
| Canonical SMILES | CC#Cc1cncc(-c2ccc3c(c2)[C@@]2(N=C(C)C(N)=N2)[C@]2(CC[C@H](OC)CC2)C3)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.24 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB14814 |
|---|---|
| Drug Name | Lanabecestat |
| CAS Number | 1383982-64-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Lanabecestat is under investigation in clinical trial NCT03499041 (A Study of LY3314814 in Participants With Liver Impairment). |
Cross-references: BindingDB: 136735 CHEMBL3989948 ChemSpider: 58177815 Wikipedia: Lanabecestat